C20H38N2 — CID 167091312
2-(4-tert-butylpiperidin-1-yl)-7-propan-2-yl-7-azaspiro[3.5]nonane (PubChem CID 167091312) has the molecular formula C20H38N2 and a molecular weight of 306.54 g/mol. Its IUPAC name is 2-(4-tert-butylpiperidin-1-yl)-7-propan-2-yl-7-azaspiro[3.5]nonane.
| Compound Name | 2-(4-tert-butylpiperidin-1-yl)-7-propan-2-yl-7-azaspiro[3.5]nonane |
|---|---|
| PubChem CID | 167091312 |
| Molecular Formula | C20H38N2 |
| Molecular Weight | 306.54 g/mol |
| Exact Mass | 306.30 |
| IUPAC Name | 2-(4-tert-butylpiperidin-1-yl)-7-propan-2-yl-7-azaspiro[3.5]nonane |
| SMILES | CC(C)N1CCC2(CC1)CC(N1CCC(C(C)(C)C)CC1)C2 |
| InChI | InChI=1S/C20H38N2/c1-16(2)21-12-8-20(9-13-21)14-18(15-20)22-10-6-17(7-11-22)19(3,4)5/h16-18H,6-15H2,1-5H3 |
| InChIKey | GKAQPHLIDMWASP-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.54 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |