C24H28Cl2F3N5OS — CID 167091376
5-chloro-N-[2-chloro-4-(trifluoromethyl)phenyl]-2-[[4-(piperidin-4-ylmethyl)piperazin-1-yl]sulfanylamino]benzamide (PubChem CID 167091376) has the molecular formula C24H28Cl2F3N5OS and a molecular weight of 562.49 g/mol. Its IUPAC name is 5-chloro-N-[2-chloro-4-(trifluoromethyl)phenyl]-2-[[4-(piperidin-4-ylmethyl)piperazin-1-yl]sulfanylamino]benzamide.
| Compound Name | 5-chloro-N-[2-chloro-4-(trifluoromethyl)phenyl]-2-[[4-(piperidin-4-ylmethyl)piperazin-1-yl]sulfanylamino]benzamide |
|---|---|
| PubChem CID | 167091376 |
| Molecular Formula | C24H28Cl2F3N5OS |
| Molecular Weight | 562.49 g/mol |
| Exact Mass | 561.13 |
| IUPAC Name | 5-chloro-N-[2-chloro-4-(trifluoromethyl)phenyl]-2-[[4-(piperidin-4-ylmethyl)piperazin-1-yl]sulfanylamino]benzamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1Cl)c1cc(Cl)ccc1NSN1CCN(CC2CCNCC2)CC1 |
| InChI | InChI=1S/C24H28Cl2F3N5OS/c25-18-2-4-21(32-36-34-11-9-33(10-12-34)15-16-5-7-30-8-6-16)19(14-18)23(35)31-22-3-1-17(13-20(22)26)24(27,28)29/h1-4,13-14,16,30,32H,5-12,15H2,(H,31,35) |
| InChIKey | NOATVFFSPNVPBS-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.49 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|