C11H15N3OS — CID 167091645
(Z)-3-cyclopropyl-2-(4-sulfanylpiperazine-1-carbonyl)prop-2-enenitrile (PubChem CID 167091645) has the molecular formula C11H15N3OS and a molecular weight of 237.33 g/mol. Its IUPAC name is (Z)-3-cyclopropyl-2-(4-sulfanylpiperazine-1-carbonyl)prop-2-enenitrile.
| Compound Name | (Z)-3-cyclopropyl-2-(4-sulfanylpiperazine-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 167091645 |
| Molecular Formula | C11H15N3OS |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | (Z)-3-cyclopropyl-2-(4-sulfanylpiperazine-1-carbonyl)prop-2-enenitrile |
| SMILES | N#C/C(=C/C1CC1)C(=O)N1CCN(S)CC1 |
| InChI | InChI=1S/C11H15N3OS/c12-8-10(7-9-1-2-9)11(15)13-3-5-14(16)6-4-13/h7,9,16H,1-6H2/b10-7- |
| InChIKey | UAUCUFKYLPLFPB-YFHOEESVSA-N |
| XLogP | 0.84 |
| TPSA | 47.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|