C29H48N6O5S — CID 167092253
(2S,4R)-1-[(2S)-3,3-dimethyl-2-[4-[[(4-methylphenyl)sulfonylamino]methyl]-1,2,3-triazaspiro[4.7]dodecan-1-yl]butanoyl]-4-hydroxy-N-methylpyrrolidine-2-carboxamide (PubChem CID 167092253) has the molecular formula C29H48N6O5S and a molecular weight of 592.81 g/mol. Its IUPAC name is (2S,4R)-1-[(2S)-3,3-dimethyl-2-[4-[[(4-methylphenyl)sulfonylamino]methyl]-1,2,3-triazaspiro[4.7]dodecan-1-yl]butanoyl]-4-hydroxy-N-methylpyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-1-[(2S)-3,3-dimethyl-2-[4-[[(4-methylphenyl)sulfonylamino]methyl]-1,2,3-triazaspiro[4.7]dodecan-1-yl]butanoyl]-4-hydroxy-N-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 167092253 |
| Molecular Formula | C29H48N6O5S |
| Molecular Weight | 592.81 g/mol |
| Exact Mass | 592.34 |
| IUPAC Name | (2S,4R)-1-[(2S)-3,3-dimethyl-2-[4-[[(4-methylphenyl)sulfonylamino]methyl]-1,2,3-triazaspiro[4.7]dodecan-1-yl]butanoyl]-4-hydroxy-N-methylpyrrolidine-2-carboxamide |
| SMILES | CNC(=O)[C@@H]1C[C@@H](O)CN1C(=O)[C@@H](N1NNC(CNS(=O)(=O)c2ccc(C)cc2)C12CCCCCCC2)C(C)(C)C |
| InChI | InChI=1S/C29H48N6O5S/c1-20-11-13-22(14-12-20)41(39,40)31-18-24-29(15-9-7-6-8-10-16-29)35(33-32-24)25(28(2,3)4)27(38)34-19-21(36)17-23(34)26(37)30-5/h11-14,21,23-25,31-33,36H,6-10,15-19H2,1-5H3,(H,30,37)/t21-,23+,24?,25-/m1/s1 |
| InChIKey | XUIXKNLILKZYCJ-AMXQZFSZSA-N |
| XLogP | 1.57 |
| TPSA | 143.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.81 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |