C34H48N6O4 — CID 167091883
(2S,4R)-1-[(2S)-3,3-dimethyl-2-[4-[4-methyl-3-(phenylcarbamoyl)phenyl]-1,2,3-triazaspiro[4.6]undecan-1-yl]butanoyl]-4-hydroxy-N-methylpyrrolidine-2-carboxamide (PubChem CID 167091883) has the molecular formula C34H48N6O4 and a molecular weight of 604.80 g/mol. Its IUPAC name is (2S,4R)-1-[(2S)-3,3-dimethyl-2-[4-[4-methyl-3-(phenylcarbamoyl)phenyl]-1,2,3-triazaspiro[4.6]undecan-1-yl]butanoyl]-4-hydroxy-N-methylpyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-1-[(2S)-3,3-dimethyl-2-[4-[4-methyl-3-(phenylcarbamoyl)phenyl]-1,2,3-triazaspiro[4.6]undecan-1-yl]butanoyl]-4-hydroxy-N-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 167091883 |
| Molecular Formula | C34H48N6O4 |
| Molecular Weight | 604.80 g/mol |
| Exact Mass | 604.37 |
| IUPAC Name | (2S,4R)-1-[(2S)-3,3-dimethyl-2-[4-[4-methyl-3-(phenylcarbamoyl)phenyl]-1,2,3-triazaspiro[4.6]undecan-1-yl]butanoyl]-4-hydroxy-N-methylpyrrolidine-2-carboxamide |
| SMILES | CNC(=O)[C@@H]1C[C@@H](O)CN1C(=O)[C@@H](N1NNC(c2ccc(C)c(C(=O)Nc3ccccc3)c2)C12CCCCCC2)C(C)(C)C |
| InChI | InChI=1S/C34H48N6O4/c1-22-15-16-23(19-26(22)30(42)36-24-13-9-8-10-14-24)28-34(17-11-6-7-12-18-34)40(38-37-28)29(33(2,3)4)32(44)39-21-25(41)20-27(39)31(43)35-5/h8-10,13-16,19,25,27-29,37-38,41H,6-7,11-12,17-18,20-21H2,1-5H3,(H,35,43)(H,36,42)/t25-,27+,28?,29-/m1/s1 |
| InChIKey | HDLHXUPRTGXBTP-LOCWQYTHSA-N |
| XLogP | 3.83 |
| TPSA | 126.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.80 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |