C28H45N5O4 — CID 167092199
(2S,4R)-4-hydroxy-1-[(2S)-2-[4-[3-(hydroxymethyl)phenyl]-1,2,3-triazaspiro[4.7]dodecan-1-yl]-3,3-dimethylbutanoyl]-N-methylpyrrolidine-2-carboxamide (PubChem CID 167092199) has the molecular formula C28H45N5O4 and a molecular weight of 515.70 g/mol. Its IUPAC name is (2S,4R)-4-hydroxy-1-[(2S)-2-[4-[3-(hydroxymethyl)phenyl]-1,2,3-triazaspiro[4.7]dodecan-1-yl]-3,3-dimethylbutanoyl]-N-methylpyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-4-hydroxy-1-[(2S)-2-[4-[3-(hydroxymethyl)phenyl]-1,2,3-triazaspiro[4.7]dodecan-1-yl]-3,3-dimethylbutanoyl]-N-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 167092199 |
| Molecular Formula | C28H45N5O4 |
| Molecular Weight | 515.70 g/mol |
| Exact Mass | 515.35 |
| IUPAC Name | (2S,4R)-4-hydroxy-1-[(2S)-2-[4-[3-(hydroxymethyl)phenyl]-1,2,3-triazaspiro[4.7]dodecan-1-yl]-3,3-dimethylbutanoyl]-N-methylpyrrolidine-2-carboxamide |
| SMILES | CNC(=O)[C@@H]1C[C@@H](O)CN1C(=O)[C@@H](N1NNC(c2cccc(CO)c2)C12CCCCCCC2)C(C)(C)C |
| InChI | InChI=1S/C28H45N5O4/c1-27(2,3)24(26(37)32-17-21(35)16-22(32)25(36)29-4)33-28(13-8-6-5-7-9-14-28)23(30-31-33)20-12-10-11-19(15-20)18-34/h10-12,15,21-24,30-31,34-35H,5-9,13-14,16-18H2,1-4H3,(H,29,36)/t21-,22+,23?,24-/m1/s1 |
| InChIKey | IYIISFLXQOMYEB-MBDJBHLASA-N |
| XLogP | 2.15 |
| TPSA | 117.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.70 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |