C19H21FN4O2 — CID 167093673
3-fluoro-4-[[4-(methoxymethyl)-6-piperazin-1-yl-2-pyridinyl]oxymethyl]benzonitrile (PubChem CID 167093673) has the molecular formula C19H21FN4O2 and a molecular weight of 356.40 g/mol. Its IUPAC name is 3-fluoro-4-[[4-(methoxymethyl)-6-piperazin-1-yl-2-pyridinyl]oxymethyl]benzonitrile.
| Compound Name | 3-fluoro-4-[[4-(methoxymethyl)-6-piperazin-1-yl-2-pyridinyl]oxymethyl]benzonitrile |
|---|---|
| PubChem CID | 167093673 |
| Molecular Formula | C19H21FN4O2 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 3-fluoro-4-[[4-(methoxymethyl)-6-piperazin-1-yl-2-pyridinyl]oxymethyl]benzonitrile |
| SMILES | COCc1cc(OCc2ccc(C#N)cc2F)nc(N2CCNCC2)c1 |
| InChI | InChI=1S/C19H21FN4O2/c1-25-12-15-9-18(24-6-4-22-5-7-24)23-19(10-15)26-13-16-3-2-14(11-21)8-17(16)20/h2-3,8-10,22H,4-7,12-13H2,1H3 |
| InChIKey | IROMWOOOJVXEAB-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 70.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |