About 3-pentyloctyl 9-[2-[9-oxo-9-(3-pentyloctoxy)nonoxy]-3-piperidin-1-ylpropoxy]nonanoate
3-pentyloctyl 9-[2-[9-oxo-9-(3-pentyloctoxy)nonoxy]-3-piperidin-1-ylpropoxy]nonanoate (PubChem CID 167096250) has the molecular formula C52H101NO6
and a molecular weight of 836.38 g/mol. Its IUPAC name is 3-pentyloctyl 9-[2-[9-oxo-9-(3-pentyloctoxy)nonoxy]-3-piperidin-1-ylpropoxy]nonanoate.
Molecular Properties
| Compound Name | 3-pentyloctyl 9-[2-[9-oxo-9-(3-pentyloctoxy)nonoxy]-3-piperidin-1-ylpropoxy]nonanoate |
| PubChem CID | 167096250 |
| Molecular Formula | C52H101NO6 |
| Molecular Weight | 836.38 g/mol |
| Exact Mass | 835.76 |
| IUPAC Name | 3-pentyloctyl 9-[2-[9-oxo-9-(3-pentyloctoxy)nonoxy]-3-piperidin-1-ylpropoxy]nonanoate |
| SMILES | CCCCCC(CCCCC)CCOC(=O)CCCCCCCCOCC(CN1CCCCC1)OCCCCCCCCC(=O)OCCC(CCCCC)CCCCC |
| InChI | InChI=1S/C52H101NO6/c1-5-9-22-32-48(33-23-10-6-2)38-44-58-51(54)36-26-17-13-15-19-30-42-56-47-50(46-53-40-28-21-29-41-53)57-43-31-20-16-14-18-27-37-52(55)59-45-39-49(34-24-11-7-3)35-25-12-8-4/h48-50H,5-47H2,1-4H3 |
| InChIKey | PAODTCLPYWSLDN-UHFFFAOYSA-N |
| XLogP | 14.76 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 59 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 836.38 |
| LogP ≤ 5 | 14.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-pentyloctyl 9-[2-[9-oxo-9-(3-pentyloctoxy)nonoxy]-3-piperidin-1-ylpropoxy]nonanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pentyloctyl 9-[2-[9-oxo-9-(3-pentyloctoxy)nonoxy]-3-piperidin-1-ylpropoxy]nonanoate?
The IUPAC name of 3-pentyloctyl 9-[2-[9-oxo-9-(3-pentyloctoxy)nonoxy]-3-piperidin-1-ylpropoxy]nonanoate (CID 167096250) is 3-pentyloctyl 9-[2-[9-oxo-9-(3-pentyloctoxy)nonoxy]-3-piperidin-1-ylpropoxy]nonanoate.
What is the SMILES notation for 3-pentyloctyl 9-[2-[9-oxo-9-(3-pentyloctoxy)nonoxy]-3-piperidin-1-ylpropoxy]nonanoate?
The canonical SMILES for 3-pentyloctyl 9-[2-[9-oxo-9-(3-pentyloctoxy)nonoxy]-3-piperidin-1-ylpropoxy]nonanoate is CCCCCC(CCCCC)CCOC(=O)CCCCCCCCOCC(CN1CCCCC1)OCCCCCCCCC(=O)OCCC(CCCCC)CCCCC.
What is the InChIKey of 3-pentyloctyl 9-[2-[9-oxo-9-(3-pentyloctoxy)nonoxy]-3-piperidin-1-ylpropoxy]nonanoate?
The InChIKey is PAODTCLPYWSLDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C52H101NO6/c1-5-9-22-32-48(33-23-10-6-2)38-44-58-51(54)36-26-17-13-15-19-30-42-56-47-50(46-53-40-28-21-29-41-53)57-43-31-20-16-14-18-27-37-52(55)59-45-39-49(34-24-11-7-3)35-25-12-8-4/h48-50H,5-47H2,1-4H3.
What are the key properties of 3-pentyloctyl 9-[2-[9-oxo-9-(3-pentyloctoxy)nonoxy]-3-piperidin-1-ylpropoxy]nonanoate?
3-pentyloctyl 9-[2-[9-oxo-9-(3-pentyloctoxy)nonoxy]-3-piperidin-1-ylpropoxy]nonanoate has a molecular weight of 836.38 g/mol, XLogP of 14.76, 45 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pentyloctyl 9-[2-[9-oxo-9-(3-pentyloctoxy)nonoxy]-3-piperidin-1-ylpropoxy]nonanoate is sourced from PubChem (CID 167096250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).