C16H20N2 — CID 167096816
[(2E,4E,6Z)-3,4-bis(ethenyl)-5-methylnona-2,4,6,8-tetraen-2-yl]-ethenyldiazene (PubChem CID 167096816) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is [(2E,4E,6Z)-3,4-bis(ethenyl)-5-methylnona-2,4,6,8-tetraen-2-yl]-ethenyldiazene.
| Compound Name | [(2E,4E,6Z)-3,4-bis(ethenyl)-5-methylnona-2,4,6,8-tetraen-2-yl]-ethenyldiazene |
|---|---|
| PubChem CID | 167096816 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | [(2E,4E,6Z)-3,4-bis(ethenyl)-5-methylnona-2,4,6,8-tetraen-2-yl]-ethenyldiazene |
| SMILES | C=C/C=C\C(C)=C(C=C)\C(C=C)=C(C)\N=N\C=C |
| InChI | InChI=1S/C16H20N2/c1-7-11-12-13(5)15(8-2)16(9-3)14(6)18-17-10-4/h7-12H,1-4H2,5-6H3/b12-11-,15-13+,16-14+,18-17+ |
| InChIKey | CAIOMZYTCGTHQM-QMISZFQHSA-N |
| XLogP | 5.29 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|