C35H50N2O7 — CID 167098104
(3R,6R,8R,9R,10R)-9-[(2S,3R,6R)-3-hydroxy-6-methyloxan-2-yl]oxy-8-methoxy-4,6,8,10,12,12-hexamethyl-3-(4-pyridin-3-ylphenyl)-1-oxa-4-azacyclotridecane-11,13-dione (PubChem CID 167098104) has the molecular formula C35H50N2O7 and a molecular weight of 610.79 g/mol. Its IUPAC name is (3R,6R,8R,9R,10R)-9-[(2S,3R,6R)-3-hydroxy-6-methyloxan-2-yl]oxy-8-methoxy-4,6,8,10,12,12-hexamethyl-3-(4-pyridin-3-ylphenyl)-1-oxa-4-azacyclotridecane-11,13-dione.
| Compound Name | (3R,6R,8R,9R,10R)-9-[(2S,3R,6R)-3-hydroxy-6-methyloxan-2-yl]oxy-8-methoxy-4,6,8,10,12,12-hexamethyl-3-(4-pyridin-3-ylphenyl)-1-oxa-4-azacyclotridecane-11,13-dione |
|---|---|
| PubChem CID | 167098104 |
| Molecular Formula | C35H50N2O7 |
| Molecular Weight | 610.79 g/mol |
| Exact Mass | 610.36 |
| IUPAC Name | (3R,6R,8R,9R,10R)-9-[(2S,3R,6R)-3-hydroxy-6-methyloxan-2-yl]oxy-8-methoxy-4,6,8,10,12,12-hexamethyl-3-(4-pyridin-3-ylphenyl)-1-oxa-4-azacyclotridecane-11,13-dione |
| SMILES | CO[C@]1(C)C[C@@H](C)CN(C)[C@H](c2ccc(-c3cccnc3)cc2)COC(=O)C(C)(C)C(=O)[C@H](C)[C@H]1O[C@@H]1O[C@H](C)CC[C@H]1O |
| InChI | InChI=1S/C35H50N2O7/c1-22-18-35(6,41-8)31(44-32-29(38)16-11-23(2)43-32)24(3)30(39)34(4,5)33(40)42-21-28(37(7)20-22)26-14-12-25(13-15-26)27-10-9-17-36-19-27/h9-10,12-15,17,19,22-24,28-29,31-32,38H,11,16,18,20-21H2,1-8H3/t22-,23-,24+,28+,29-,31-,32+,35-/m1/s1 |
| InChIKey | XWGMLSLFHHYWQT-UMASJYTPSA-N |
| XLogP | 5.21 |
| TPSA | 107.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.79 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|