C31H42N8O2 — CID 167100562
N-[2-[2-(dimethylamino)ethyl-methylamino]-4-ethoxy-5-[[4-(3,3,5,6-tetramethyl-2H-pyrrolo[3,2-b]pyridin-1-yl)pyrimidin-2-yl]amino]phenyl]prop-2-enamide (PubChem CID 167100562) has the molecular formula C31H42N8O2 and a molecular weight of 558.73 g/mol. Its IUPAC name is N-[2-[2-(dimethylamino)ethyl-methylamino]-4-ethoxy-5-[[4-(3,3,5,6-tetramethyl-2H-pyrrolo[3,2-b]pyridin-1-yl)pyrimidin-2-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[2-[2-(dimethylamino)ethyl-methylamino]-4-ethoxy-5-[[4-(3,3,5,6-tetramethyl-2H-pyrrolo[3,2-b]pyridin-1-yl)pyrimidin-2-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 167100562 |
| Molecular Formula | C31H42N8O2 |
| Molecular Weight | 558.73 g/mol |
| Exact Mass | 558.34 |
| IUPAC Name | N-[2-[2-(dimethylamino)ethyl-methylamino]-4-ethoxy-5-[[4-(3,3,5,6-tetramethyl-2H-pyrrolo[3,2-b]pyridin-1-yl)pyrimidin-2-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2nccc(N3CC(C)(C)c4nc(C)c(C)cc43)n2)c(OCC)cc1N(C)CCN(C)C |
| InChI | InChI=1S/C31H42N8O2/c1-10-28(40)34-22-17-23(26(41-11-2)18-24(22)38(9)15-14-37(7)8)35-30-32-13-12-27(36-30)39-19-31(5,6)29-25(39)16-20(3)21(4)33-29/h10,12-13,16-18H,1,11,14-15,19H2,2-9H3,(H,34,40)(H,32,35,36) |
| InChIKey | PEHYTCPXIXOIPK-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 98.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.73 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|