About S-phenyl N-(2-propan-2-yloxyethyl)carbamothioate
S-phenyl N-(2-propan-2-yloxyethyl)carbamothioate (PubChem CID 167100984) has the molecular formula C12H17NO2S
and a molecular weight of 239.34 g/mol. Its IUPAC name is S-phenyl N-(2-propan-2-yloxyethyl)carbamothioate.
Molecular Properties
| Compound Name | S-phenyl N-(2-propan-2-yloxyethyl)carbamothioate |
| PubChem CID | 167100984 |
| Molecular Formula | C12H17NO2S |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | S-phenyl N-(2-propan-2-yloxyethyl)carbamothioate |
| SMILES | CC(C)OCCNC(=O)Sc1ccccc1 |
| InChI | InChI=1S/C12H17NO2S/c1-10(2)15-9-8-13-12(14)16-11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3,(H,13,14) |
| InChIKey | SQGYAYDRJDPUEP-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-phenyl N-(2-propan-2-yloxyethyl)carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-phenyl N-(2-propan-2-yloxyethyl)carbamothioate?
The IUPAC name of S-phenyl N-(2-propan-2-yloxyethyl)carbamothioate (CID 167100984) is S-phenyl N-(2-propan-2-yloxyethyl)carbamothioate.
What is the SMILES notation for S-phenyl N-(2-propan-2-yloxyethyl)carbamothioate?
The canonical SMILES for S-phenyl N-(2-propan-2-yloxyethyl)carbamothioate is CC(C)OCCNC(=O)Sc1ccccc1.
What is the InChIKey of S-phenyl N-(2-propan-2-yloxyethyl)carbamothioate?
The InChIKey is SQGYAYDRJDPUEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2S/c1-10(2)15-9-8-13-12(14)16-11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3,(H,13,14).
What are the key properties of S-phenyl N-(2-propan-2-yloxyethyl)carbamothioate?
S-phenyl N-(2-propan-2-yloxyethyl)carbamothioate has a molecular weight of 239.34 g/mol, XLogP of 2.91, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-phenyl N-(2-propan-2-yloxyethyl)carbamothioate is sourced from PubChem (CID 167100984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).