C23H20ClF3N4O2S — CID 167101595
(2E,4Z)-4-(2-amino-1,3-benzothiazol-6-yl)-5-chloro-2-methyl-5-(methylideneamino)-N-[1-[2-(trifluoromethoxy)phenyl]ethyl]penta-2,4-dienamide (PubChem CID 167101595) has the molecular formula C23H20ClF3N4O2S and a molecular weight of 508.95 g/mol. Its IUPAC name is (2E,4Z)-4-(2-amino-1,3-benzothiazol-6-yl)-5-chloro-2-methyl-5-(methylideneamino)-N-[1-[2-(trifluoromethoxy)phenyl]ethyl]penta-2,4-dienamide.
| Compound Name | (2E,4Z)-4-(2-amino-1,3-benzothiazol-6-yl)-5-chloro-2-methyl-5-(methylideneamino)-N-[1-[2-(trifluoromethoxy)phenyl]ethyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 167101595 |
| Molecular Formula | C23H20ClF3N4O2S |
| Molecular Weight | 508.95 g/mol |
| Exact Mass | 508.09 |
| IUPAC Name | (2E,4Z)-4-(2-amino-1,3-benzothiazol-6-yl)-5-chloro-2-methyl-5-(methylideneamino)-N-[1-[2-(trifluoromethoxy)phenyl]ethyl]penta-2,4-dienamide |
| SMILES | C=N/C(Cl)=C(\C=C(/C)C(=O)NC(C)c1ccccc1OC(F)(F)F)c1ccc2nc(N)sc2c1 |
| InChI | InChI=1S/C23H20ClF3N4O2S/c1-12(21(32)30-13(2)15-6-4-5-7-18(15)33-23(25,26)27)10-16(20(24)29-3)14-8-9-17-19(11-14)34-22(28)31-17/h4-11,13H,3H2,1-2H3,(H2,28,31)(H,30,32)/b12-10+,20-16+ |
| InChIKey | FIFXSSMJAIQEIX-KLGBTMNESA-N |
| XLogP | 6.21 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.95 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|