C23H19N3O2S — CID 167101693
2-ethynyl-N-[2-[3-(1-methyl-2-oxo-3H-indol-4-yl)phenyl]ethyl]-1,3-thiazole-4-carboxamide (PubChem CID 167101693) has the molecular formula C23H19N3O2S and a molecular weight of 401.49 g/mol. Its IUPAC name is 2-ethynyl-N-[2-[3-(1-methyl-2-oxo-3H-indol-4-yl)phenyl]ethyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-ethynyl-N-[2-[3-(1-methyl-2-oxo-3H-indol-4-yl)phenyl]ethyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 167101693 |
| Molecular Formula | C23H19N3O2S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 2-ethynyl-N-[2-[3-(1-methyl-2-oxo-3H-indol-4-yl)phenyl]ethyl]-1,3-thiazole-4-carboxamide |
| SMILES | C#Cc1nc(C(=O)NCCc2cccc(-c3cccc4c3CC(=O)N4C)c2)cs1 |
| InChI | InChI=1S/C23H19N3O2S/c1-3-21-25-19(14-29-21)23(28)24-11-10-15-6-4-7-16(12-15)17-8-5-9-20-18(17)13-22(27)26(20)2/h1,4-9,12,14H,10-11,13H2,2H3,(H,24,28) |
| InChIKey | GFEYPAUAOLYSHY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|