C14H13F3N4O2S — CID 167103903
methylamino-[1-[[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]thiophen-2-yl]methyl]pyrrol-2-yl]methanol (PubChem CID 167103903) has the molecular formula C14H13F3N4O2S and a molecular weight of 358.35 g/mol. Its IUPAC name is methylamino-[1-[[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]thiophen-2-yl]methyl]pyrrol-2-yl]methanol.
| Compound Name | methylamino-[1-[[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]thiophen-2-yl]methyl]pyrrol-2-yl]methanol |
|---|---|
| PubChem CID | 167103903 |
| Molecular Formula | C14H13F3N4O2S |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | methylamino-[1-[[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]thiophen-2-yl]methyl]pyrrol-2-yl]methanol |
| SMILES | CNC(O)c1cccn1Cc1ccc(-c2noc(C(F)(F)F)n2)s1 |
| InChI | InChI=1S/C14H13F3N4O2S/c1-18-12(22)9-3-2-6-21(9)7-8-4-5-10(24-8)11-19-13(23-20-11)14(15,16)17/h2-6,12,18,22H,7H2,1H3 |
| InChIKey | FAMVVEFOHXLQQC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|