C13H14F3N3O4S — CID 142423273
N,2-dimethoxy-N-[[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]thiophen-2-yl]methyl]propanamide (PubChem CID 142423273) has the molecular formula C13H14F3N3O4S and a molecular weight of 365.33 g/mol. Its IUPAC name is N,2-dimethoxy-N-[[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]thiophen-2-yl]methyl]propanamide.
| Compound Name | N,2-dimethoxy-N-[[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]thiophen-2-yl]methyl]propanamide |
|---|---|
| PubChem CID | 142423273 |
| Molecular Formula | C13H14F3N3O4S |
| Molecular Weight | 365.33 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | N,2-dimethoxy-N-[[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]thiophen-2-yl]methyl]propanamide |
| SMILES | COC(C)C(=O)N(Cc1ccc(-c2noc(C(F)(F)F)n2)s1)OC |
| InChI | InChI=1S/C13H14F3N3O4S/c1-7(21-2)11(20)19(22-3)6-8-4-5-9(24-8)10-17-12(23-18-10)13(14,15)16/h4-5,7H,6H2,1-3H3 |
| InChIKey | PFSQWBIAAMMVQJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 77.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|