C15H15F4N3O4 — CID 135283747
N-[[3-fluoro-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]-N,2-dimethoxypropanamide (PubChem CID 135283747) has the molecular formula C15H15F4N3O4 and a molecular weight of 377.29 g/mol. Its IUPAC name is N-[[3-fluoro-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]-N,2-dimethoxypropanamide.
| Compound Name | N-[[3-fluoro-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]-N,2-dimethoxypropanamide |
|---|---|
| PubChem CID | 135283747 |
| Molecular Formula | C15H15F4N3O4 |
| Molecular Weight | 377.29 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | N-[[3-fluoro-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]-N,2-dimethoxypropanamide |
| SMILES | COC(C)C(=O)N(Cc1ccc(-c2noc(C(F)(F)F)n2)c(F)c1)OC |
| InChI | InChI=1S/C15H15F4N3O4/c1-8(24-2)13(23)22(25-3)7-9-4-5-10(11(16)6-9)12-20-14(26-21-12)15(17,18)19/h4-6,8H,7H2,1-3H3 |
| InChIKey | ZMXQHCVGNRRSBD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 77.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|