C10H10F3N3O4S2 — CID 142423341
N-methoxy-N-[[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]thiophen-2-yl]methyl]methanesulfonamide (PubChem CID 142423341) has the molecular formula C10H10F3N3O4S2 and a molecular weight of 357.34 g/mol. Its IUPAC name is N-methoxy-N-[[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]thiophen-2-yl]methyl]methanesulfonamide.
| Compound Name | N-methoxy-N-[[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]thiophen-2-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 142423341 |
| Molecular Formula | C10H10F3N3O4S2 |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | N-methoxy-N-[[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]thiophen-2-yl]methyl]methanesulfonamide |
| SMILES | CON(Cc1ccc(-c2noc(C(F)(F)F)n2)s1)S(C)(=O)=O |
| InChI | InChI=1S/C10H10F3N3O4S2/c1-19-16(22(2,17)18)5-6-3-4-7(21-6)8-14-9(20-15-8)10(11,12)13/h3-4H,5H2,1-2H3 |
| InChIKey | LBRBHDUVYOXBKY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 85.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|