C11H9F3N4O3S — CID 146662686
N'-methyl-N'-[[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]thiophen-2-yl]methyl]oxamide (PubChem CID 146662686) has the molecular formula C11H9F3N4O3S and a molecular weight of 334.28 g/mol. Its IUPAC name is N'-methyl-N'-[[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]thiophen-2-yl]methyl]oxamide.
| Compound Name | N'-methyl-N'-[[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]thiophen-2-yl]methyl]oxamide |
|---|---|
| PubChem CID | 146662686 |
| Molecular Formula | C11H9F3N4O3S |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | N'-methyl-N'-[[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]thiophen-2-yl]methyl]oxamide |
| SMILES | CN(Cc1ccc(-c2noc(C(F)(F)F)n2)s1)C(=O)C(N)=O |
| InChI | InChI=1S/C11H9F3N4O3S/c1-18(9(20)7(15)19)4-5-2-3-6(22-5)8-16-10(21-17-8)11(12,13)14/h2-3H,4H2,1H3,(H2,15,19) |
| InChIKey | HEFDDUMMKABYMV-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|