C13H13F3N4O3S — CID 142423267
N'-propan-2-yl-N'-[[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]thiophen-2-yl]methyl]oxamide (PubChem CID 142423267) has the molecular formula C13H13F3N4O3S and a molecular weight of 362.33 g/mol. Its IUPAC name is N'-propan-2-yl-N'-[[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]thiophen-2-yl]methyl]oxamide.
| Compound Name | N'-propan-2-yl-N'-[[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]thiophen-2-yl]methyl]oxamide |
|---|---|
| PubChem CID | 142423267 |
| Molecular Formula | C13H13F3N4O3S |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | N'-propan-2-yl-N'-[[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]thiophen-2-yl]methyl]oxamide |
| SMILES | CC(C)N(Cc1ccc(-c2noc(C(F)(F)F)n2)s1)C(=O)C(N)=O |
| InChI | InChI=1S/C13H13F3N4O3S/c1-6(2)20(11(22)9(17)21)5-7-3-4-8(24-7)10-18-12(23-19-10)13(14,15)16/h3-4,6H,5H2,1-2H3,(H2,17,21) |
| InChIKey | FZGBNOWULZMYBY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|