C18H12F5N3O4S — CID 142423266
N-(2,2-difluoroethoxy)-2-oxo-2-phenyl-N-[[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]thiophen-2-yl]methyl]acetamide (PubChem CID 142423266) has the molecular formula C18H12F5N3O4S and a molecular weight of 461.37 g/mol. Its IUPAC name is N-(2,2-difluoroethoxy)-2-oxo-2-phenyl-N-[[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]thiophen-2-yl]methyl]acetamide.
| Compound Name | N-(2,2-difluoroethoxy)-2-oxo-2-phenyl-N-[[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]thiophen-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 142423266 |
| Molecular Formula | C18H12F5N3O4S |
| Molecular Weight | 461.37 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | N-(2,2-difluoroethoxy)-2-oxo-2-phenyl-N-[[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]thiophen-2-yl]methyl]acetamide |
| SMILES | O=C(C(=O)N(Cc1ccc(-c2noc(C(F)(F)F)n2)s1)OCC(F)F)c1ccccc1 |
| InChI | InChI=1S/C18H12F5N3O4S/c19-13(20)9-29-26(16(28)14(27)10-4-2-1-3-5-10)8-11-6-7-12(31-11)15-24-17(30-25-15)18(21,22)23/h1-7,13H,8-9H2 |
| InChIKey | KTWJFAVYAIOAKG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 85.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.37 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|