C16H9F3N2O4S — CID 146293267
benzyl 2-oxo-2-[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]thiophen-2-yl]acetate (PubChem CID 146293267) has the molecular formula C16H9F3N2O4S and a molecular weight of 382.32 g/mol. Its IUPAC name is benzyl 2-oxo-2-[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]thiophen-2-yl]acetate.
| Compound Name | benzyl 2-oxo-2-[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]thiophen-2-yl]acetate |
|---|---|
| PubChem CID | 146293267 |
| Molecular Formula | C16H9F3N2O4S |
| Molecular Weight | 382.32 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | benzyl 2-oxo-2-[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]thiophen-2-yl]acetate |
| SMILES | O=C(OCc1ccccc1)C(=O)c1ccc(-c2noc(C(F)(F)F)n2)s1 |
| InChI | InChI=1S/C16H9F3N2O4S/c17-16(18,19)15-20-13(21-25-15)11-7-6-10(26-11)12(22)14(23)24-8-9-4-2-1-3-5-9/h1-7H,8H2 |
| InChIKey | COIOUKRXTKISBW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 82.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|