C8H18N2OS — CID 167106962
(3S,4R)-1-methylsulfanyl-4-(propan-2-ylamino)pyrrolidin-3-ol (PubChem CID 167106962) has the molecular formula C8H18N2OS and a molecular weight of 190.31 g/mol. Its IUPAC name is (3S,4R)-1-methylsulfanyl-4-(propan-2-ylamino)pyrrolidin-3-ol.
| Compound Name | (3S,4R)-1-methylsulfanyl-4-(propan-2-ylamino)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 167106962 |
| Molecular Formula | C8H18N2OS |
| Molecular Weight | 190.31 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | (3S,4R)-1-methylsulfanyl-4-(propan-2-ylamino)pyrrolidin-3-ol |
| SMILES | CSN1C[C@H](O)[C@H](NC(C)C)C1 |
| InChI | InChI=1S/C8H18N2OS/c1-6(2)9-7-4-10(12-3)5-8(7)11/h6-9,11H,4-5H2,1-3H3/t7-,8+/m1/s1 |
| InChIKey | RKNJJWHSUMVKKW-SFYZADRCSA-N |
| XLogP | 0.31 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.31 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|