C7H14N2S — CID 134435149
6-methyl-3-methylsulfanyl-3,6-diazabicyclo[3.1.1]heptane (PubChem CID 134435149) has the molecular formula C7H14N2S and a molecular weight of 158.27 g/mol. Its IUPAC name is 6-methyl-3-methylsulfanyl-3,6-diazabicyclo[3.1.1]heptane.
| Compound Name | 6-methyl-3-methylsulfanyl-3,6-diazabicyclo[3.1.1]heptane |
|---|---|
| PubChem CID | 134435149 |
| Molecular Formula | C7H14N2S |
| Molecular Weight | 158.27 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 6-methyl-3-methylsulfanyl-3,6-diazabicyclo[3.1.1]heptane |
| SMILES | CSN1CC2CC(C1)N2C |
| InChI | InChI=1S/C7H14N2S/c1-8-6-3-7(8)5-9(4-6)10-2/h6-7H,3-5H2,1-2H3 |
| InChIKey | ZBKILWIZACDAJA-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.27 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|