C17H26N2O2 — CID 167108291
(E)-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-4,4,5-trimethylhex-2-enamide (PubChem CID 167108291) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is (E)-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-4,4,5-trimethylhex-2-enamide.
| Compound Name | (E)-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-4,4,5-trimethylhex-2-enamide |
|---|---|
| PubChem CID | 167108291 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | (E)-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-4,4,5-trimethylhex-2-enamide |
| SMILES | Cc1cc(C)c(CNC(=O)/C=C/C(C)(C)C(C)C)c(=O)[nH]1 |
| InChI | InChI=1S/C17H26N2O2/c1-11(2)17(5,6)8-7-15(20)18-10-14-12(3)9-13(4)19-16(14)21/h7-9,11H,10H2,1-6H3,(H,18,20)(H,19,21)/b8-7+ |
| InChIKey | KUTQUSWHWIRRMC-BQYQJAHWSA-N |
| XLogP | 2.85 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|