C12H18O4 — CID 167108537
8,11-dioxadispiro[3.2.47.24]tridecan-2-yl formate (PubChem CID 167108537) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is 8,11-dioxadispiro[3.2.47.24]tridecan-2-yl formate.
| Compound Name | 8,11-dioxadispiro[3.2.47.24]tridecan-2-yl formate |
|---|---|
| PubChem CID | 167108537 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 8,11-dioxadispiro[3.2.47.24]tridecan-2-yl formate |
| SMILES | O=COC1CC2(CCC3(CC2)OCCO3)C1 |
| InChI | InChI=1S/C12H18O4/c13-9-14-10-7-11(8-10)1-3-12(4-2-11)15-5-6-16-12/h9-10H,1-8H2 |
| InChIKey | CBOPEWYOTUGHGG-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|