C21H24N6O3 — CID 167108657
4-amino-5-[(3-hydroxycyclohexyl)iminomethyl]-N-imidazo[1,2-b]pyridazin-3-yl-2-methoxybenzamide (PubChem CID 167108657) has the molecular formula C21H24N6O3 and a molecular weight of 408.46 g/mol. Its IUPAC name is 4-amino-5-[(3-hydroxycyclohexyl)iminomethyl]-N-imidazo[1,2-b]pyridazin-3-yl-2-methoxybenzamide.
| Compound Name | 4-amino-5-[(3-hydroxycyclohexyl)iminomethyl]-N-imidazo[1,2-b]pyridazin-3-yl-2-methoxybenzamide |
|---|---|
| PubChem CID | 167108657 |
| Molecular Formula | C21H24N6O3 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 4-amino-5-[(3-hydroxycyclohexyl)iminomethyl]-N-imidazo[1,2-b]pyridazin-3-yl-2-methoxybenzamide |
| SMILES | COc1cc(N)c(/C=N/C2CCCC(O)C2)cc1C(=O)Nc1cnc2cccnn12 |
| InChI | InChI=1S/C21H24N6O3/c1-30-18-10-17(22)13(11-23-14-4-2-5-15(28)9-14)8-16(18)21(29)26-20-12-24-19-6-3-7-25-27(19)20/h3,6-8,10-12,14-15,28H,2,4-5,9,22H2,1H3,(H,26,29)/b23-11+ |
| InChIKey | HUEWKRFPCMZYCJ-FOKLQQMPSA-N |
| XLogP | 2.29 |
| TPSA | 127.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|