C21H25N7O2 — CID 163396531
4-amino-5-[(4-aminocyclohexyl)iminomethyl]-2-methoxy-N-pyrazolo[1,5-a]pyrimidin-3-ylbenzamide (PubChem CID 163396531) has the molecular formula C21H25N7O2 and a molecular weight of 407.48 g/mol. Its IUPAC name is 4-amino-5-[(4-aminocyclohexyl)iminomethyl]-2-methoxy-N-pyrazolo[1,5-a]pyrimidin-3-ylbenzamide.
| Compound Name | 4-amino-5-[(4-aminocyclohexyl)iminomethyl]-2-methoxy-N-pyrazolo[1,5-a]pyrimidin-3-ylbenzamide |
|---|---|
| PubChem CID | 163396531 |
| Molecular Formula | C21H25N7O2 |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | 4-amino-5-[(4-aminocyclohexyl)iminomethyl]-2-methoxy-N-pyrazolo[1,5-a]pyrimidin-3-ylbenzamide |
| SMILES | COc1cc(N)c(/C=N/C2CCC(N)CC2)cc1C(=O)Nc1cnn2cccnc12 |
| InChI | InChI=1S/C21H25N7O2/c1-30-19-10-17(23)13(11-25-15-5-3-14(22)4-6-15)9-16(19)21(29)27-18-12-26-28-8-2-7-24-20(18)28/h2,7-12,14-15H,3-6,22-23H2,1H3,(H,27,29)/b25-11+ |
| InChIKey | VITVNBHSQUVALZ-OPEKNORGSA-N |
| XLogP | 2.26 |
| TPSA | 132.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|