C28H40N4O3 — CID 177065302
4-amino-N-(1-cyclopropyl-2-oxo-3-pyridinyl)-2-methoxy-5-[(4-propylcyclohexyl)iminomethyl]benzamide;ethane (PubChem CID 177065302) has the molecular formula C28H40N4O3 and a molecular weight of 480.65 g/mol. Its IUPAC name is 4-amino-N-(1-cyclopropyl-2-oxo-3-pyridinyl)-2-methoxy-5-[(4-propylcyclohexyl)iminomethyl]benzamide;ethane.
| Compound Name | 4-amino-N-(1-cyclopropyl-2-oxo-3-pyridinyl)-2-methoxy-5-[(4-propylcyclohexyl)iminomethyl]benzamide;ethane |
|---|---|
| PubChem CID | 177065302 |
| Molecular Formula | C28H40N4O3 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.31 |
| IUPAC Name | 4-amino-N-(1-cyclopropyl-2-oxo-3-pyridinyl)-2-methoxy-5-[(4-propylcyclohexyl)iminomethyl]benzamide;ethane |
| SMILES | CC.CCCC1CCC(/N=C/c2cc(C(=O)Nc3cccn(C4CC4)c3=O)c(OC)cc2N)CC1 |
| InChI | InChI=1S/C26H34N4O3.C2H6/c1-3-5-17-7-9-19(10-8-17)28-16-18-14-21(24(33-2)15-22(18)27)25(31)29-23-6-4-13-30(26(23)32)20-11-12-20;1-2/h4,6,13-17,19-20H,3,5,7-12,27H2,1-2H3,(H,29,31);1-2H3/b28-16+; |
| InChIKey | IENCPGLCFRWFNH-HRRMWDOSSA-N |
| XLogP | 5.83 |
| TPSA | 98.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|