C21H27N4O3+ — CID 167113963
N-[4-amino-5-(cyclohexyliminomethyl)-2-methoxyphenyl]-1-hydroxy-6-methylpyridin-1-ium-2-carboxamide (PubChem CID 167113963) has the molecular formula C21H27N4O3+ and a molecular weight of 383.47 g/mol. Its IUPAC name is N-[4-amino-5-(cyclohexyliminomethyl)-2-methoxyphenyl]-1-hydroxy-6-methylpyridin-1-ium-2-carboxamide.
| Compound Name | N-[4-amino-5-(cyclohexyliminomethyl)-2-methoxyphenyl]-1-hydroxy-6-methylpyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 167113963 |
| Molecular Formula | C21H27N4O3+ |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | N-[4-amino-5-(cyclohexyliminomethyl)-2-methoxyphenyl]-1-hydroxy-6-methylpyridin-1-ium-2-carboxamide |
| SMILES | COc1cc(N)c(/C=N/C2CCCCC2)cc1NC(=O)c1cccc(C)[n+]1O |
| InChI | InChI=1S/C21H26N4O3/c1-14-7-6-10-19(25(14)27)21(26)24-18-11-15(17(22)12-20(18)28-2)13-23-16-8-4-3-5-9-16/h6-7,10-13,16,22,26-27H,3-5,8-9H2,1-2H3/p+1/b23-13+ |
| InChIKey | DTCJQHRRFRAEBF-YDZHTSKRSA-O |
| XLogP | 3.11 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|