C28H38N5O4+ — CID 170351216
N-[4-amino-5-[(4-cyclopropyl-4-hydroxycyclohexyl)iminomethyl]-2-(cyclopropylmethoxy)phenyl]-6-(dimethylamino)-1-hydroxypyridin-1-ium-2-carboxamide (PubChem CID 170351216) has the molecular formula C28H38N5O4+ and a molecular weight of 508.64 g/mol. Its IUPAC name is N-[4-amino-5-[(4-cyclopropyl-4-hydroxycyclohexyl)iminomethyl]-2-(cyclopropylmethoxy)phenyl]-6-(dimethylamino)-1-hydroxypyridin-1-ium-2-carboxamide.
| Compound Name | N-[4-amino-5-[(4-cyclopropyl-4-hydroxycyclohexyl)iminomethyl]-2-(cyclopropylmethoxy)phenyl]-6-(dimethylamino)-1-hydroxypyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 170351216 |
| Molecular Formula | C28H38N5O4+ |
| Molecular Weight | 508.64 g/mol |
| Exact Mass | 508.29 |
| IUPAC Name | N-[4-amino-5-[(4-cyclopropyl-4-hydroxycyclohexyl)iminomethyl]-2-(cyclopropylmethoxy)phenyl]-6-(dimethylamino)-1-hydroxypyridin-1-ium-2-carboxamide |
| SMILES | CN(C)c1cccc(C(=O)Nc2cc(/C=N/C3CCC(O)(C4CC4)CC3)c(N)cc2OCC2CC2)[n+]1O |
| InChI | InChI=1S/C28H37N5O4/c1-32(2)26-5-3-4-24(33(26)36)27(34)31-23-14-19(22(29)15-25(23)37-17-18-6-7-18)16-30-21-10-12-28(35,13-11-21)20-8-9-20/h3-5,14-16,18,20-21,29,34-36H,6-13,17H2,1-2H3/p+1/b30-16+ |
| InChIKey | NQUHMOPIBDSTLA-OKCVXOCRSA-O |
| XLogP | 3.40 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.64 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|