C27H35N4O3+ — CID 170361096
N-[4-amino-5-[(4-cyclopropylcyclohexyl)iminomethyl]-2-ethoxyphenyl]-6-cyclopropyl-1-hydroxypyridin-1-ium-2-carboxamide (PubChem CID 170361096) has the molecular formula C27H35N4O3+ and a molecular weight of 463.60 g/mol. Its IUPAC name is N-[4-amino-5-[(4-cyclopropylcyclohexyl)iminomethyl]-2-ethoxyphenyl]-6-cyclopropyl-1-hydroxypyridin-1-ium-2-carboxamide.
| Compound Name | N-[4-amino-5-[(4-cyclopropylcyclohexyl)iminomethyl]-2-ethoxyphenyl]-6-cyclopropyl-1-hydroxypyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 170361096 |
| Molecular Formula | C27H35N4O3+ |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.27 |
| IUPAC Name | N-[4-amino-5-[(4-cyclopropylcyclohexyl)iminomethyl]-2-ethoxyphenyl]-6-cyclopropyl-1-hydroxypyridin-1-ium-2-carboxamide |
| SMILES | CCOc1cc(N)c(/C=N/C2CCC(C3CC3)CC2)cc1NC(=O)c1cccc(C2CC2)[n+]1O |
| InChI | InChI=1S/C27H34N4O3/c1-2-34-26-15-22(28)20(16-29-21-12-10-18(11-13-21)17-6-7-17)14-23(26)30-27(32)25-5-3-4-24(31(25)33)19-8-9-19/h3-5,14-19,21,28,32-33H,2,6-13H2,1H3/p+1/b29-16+ |
| InChIKey | STHFQLQVNLZXCL-MUFRIFMGSA-O |
| XLogP | 4.71 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|