C17H21N4O3+ — CID 170361230
N-[4-amino-2-ethoxy-5-(methyliminomethyl)phenyl]-1-hydroxy-6-methylpyridin-1-ium-2-carboxamide (PubChem CID 170361230) has the molecular formula C17H21N4O3+ and a molecular weight of 329.38 g/mol. Its IUPAC name is N-[4-amino-2-ethoxy-5-(methyliminomethyl)phenyl]-1-hydroxy-6-methylpyridin-1-ium-2-carboxamide.
| Compound Name | N-[4-amino-2-ethoxy-5-(methyliminomethyl)phenyl]-1-hydroxy-6-methylpyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 170361230 |
| Molecular Formula | C17H21N4O3+ |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | N-[4-amino-2-ethoxy-5-(methyliminomethyl)phenyl]-1-hydroxy-6-methylpyridin-1-ium-2-carboxamide |
| SMILES | CCOc1cc(N)c(/C=N/C)cc1NC(=O)c1cccc(C)[n+]1O |
| InChI | InChI=1S/C17H20N4O3/c1-4-24-16-9-13(18)12(10-19-3)8-14(16)20-17(22)15-7-5-6-11(2)21(15)23/h5-10,18,22-23H,4H2,1-3H3/p+1/b19-10+ |
| InChIKey | BWVXOADSTIUYTN-VXLYETTFSA-O |
| XLogP | 1.80 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|