C26H33N4O4+ — CID 170348342
N-[4-amino-2-(cyclopropylmethoxy)-5-[(4-hydroxycyclohexyl)iminomethyl]phenyl]-6-cyclopropyl-1-hydroxypyridin-1-ium-2-carboxamide (PubChem CID 170348342) has the molecular formula C26H33N4O4+ and a molecular weight of 465.57 g/mol. Its IUPAC name is N-[4-amino-2-(cyclopropylmethoxy)-5-[(4-hydroxycyclohexyl)iminomethyl]phenyl]-6-cyclopropyl-1-hydroxypyridin-1-ium-2-carboxamide.
| Compound Name | N-[4-amino-2-(cyclopropylmethoxy)-5-[(4-hydroxycyclohexyl)iminomethyl]phenyl]-6-cyclopropyl-1-hydroxypyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 170348342 |
| Molecular Formula | C26H33N4O4+ |
| Molecular Weight | 465.57 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | N-[4-amino-2-(cyclopropylmethoxy)-5-[(4-hydroxycyclohexyl)iminomethyl]phenyl]-6-cyclopropyl-1-hydroxypyridin-1-ium-2-carboxamide |
| SMILES | Nc1cc(OCC2CC2)c(NC(=O)c2cccc(C3CC3)[n+]2O)cc1/C=N/C1CCC(O)CC1 |
| InChI | InChI=1S/C26H32N4O4/c27-21-13-25(34-15-16-4-5-16)22(12-18(21)14-28-19-8-10-20(31)11-9-19)29-26(32)24-3-1-2-23(30(24)33)17-6-7-17/h1-3,12-14,16-17,19-20,27,31-33H,4-11,15H2/p+1/b28-14+ |
| InChIKey | POMPBOODJBTSEP-CCVNUDIWSA-O |
| XLogP | 3.43 |
| TPSA | 121.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.57 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|