C46H52N8O8 — CID 167618895
6-cyclopropyl-N-[2-(4-hydroxycyclohexyl)-6-methoxyindazol-5-yl]-1-oxidopyridin-1-ium-2-carboxamide (PubChem CID 167618895) has the molecular formula C46H52N8O8 and a molecular weight of 844.97 g/mol. Its IUPAC name is 6-cyclopropyl-N-[2-(4-hydroxycyclohexyl)-6-methoxyindazol-5-yl]-1-oxidopyridin-1-ium-2-carboxamide.
| Compound Name | 6-cyclopropyl-N-[2-(4-hydroxycyclohexyl)-6-methoxyindazol-5-yl]-1-oxidopyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 167618895 |
| Molecular Formula | C46H52N8O8 |
| Molecular Weight | 844.97 g/mol |
| Exact Mass | 844.39 |
| IUPAC Name | 6-cyclopropyl-N-[2-(4-hydroxycyclohexyl)-6-methoxyindazol-5-yl]-1-oxidopyridin-1-ium-2-carboxamide |
| SMILES | COc1cc2nn(C3CCC(O)CC3)cc2cc1NC(=O)c1cccc(C2CC2)[n+]1[O-].COc1cc2nn(C3CCC(O)CC3)cc2cc1NC(=O)c1cccc(C2CC2)[n+]1[O-] |
| InChI | InChI=1S/2C23H26N4O4/c2*1-31-22-12-18-15(13-26(25-18)16-7-9-17(28)10-8-16)11-19(22)24-23(29)21-4-2-3-20(27(21)30)14-5-6-14/h2*2-4,11-14,16-17,28H,5-10H2,1H3,(H,24,29) |
| InChIKey | MDPCCJQUNUMBKN-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 206.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.97 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|