C25H28F2N4O4 — CID 165162290
N-[2-(4-cyclopropyl-4-hydroxycyclohexyl)-6-methoxyindazol-5-yl]-6-(1,1-difluoroethyl)-1-oxidopyridin-1-ium-2-carboxamide (PubChem CID 165162290) has the molecular formula C25H28F2N4O4 and a molecular weight of 486.52 g/mol. Its IUPAC name is N-[2-(4-cyclopropyl-4-hydroxycyclohexyl)-6-methoxyindazol-5-yl]-6-(1,1-difluoroethyl)-1-oxidopyridin-1-ium-2-carboxamide.
| Compound Name | N-[2-(4-cyclopropyl-4-hydroxycyclohexyl)-6-methoxyindazol-5-yl]-6-(1,1-difluoroethyl)-1-oxidopyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 165162290 |
| Molecular Formula | C25H28F2N4O4 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | N-[2-(4-cyclopropyl-4-hydroxycyclohexyl)-6-methoxyindazol-5-yl]-6-(1,1-difluoroethyl)-1-oxidopyridin-1-ium-2-carboxamide |
| SMILES | COc1cc2nn(C3CCC(O)(C4CC4)CC3)cc2cc1NC(=O)c1cccc(C(C)(F)F)[n+]1[O-] |
| InChI | InChI=1S/C25H28F2N4O4/c1-24(26,27)22-5-3-4-20(31(22)34)23(32)28-19-12-15-14-30(29-18(15)13-21(19)35-2)17-8-10-25(33,11-9-17)16-6-7-16/h3-5,12-14,16-17,33H,6-11H2,1-2H3,(H,28,32) |
| InChIKey | QQMLNSPQUXOAGN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|