C28H32N4O4 — CID 165162120
N-[6-(cyclopropylmethoxy)-2-(4-ethynyl-4-hydroxycyclohexyl)indazol-5-yl]-1-oxido-6-propan-2-ylpyridin-1-ium-2-carboxamide (PubChem CID 165162120) has the molecular formula C28H32N4O4 and a molecular weight of 488.59 g/mol. Its IUPAC name is N-[6-(cyclopropylmethoxy)-2-(4-ethynyl-4-hydroxycyclohexyl)indazol-5-yl]-1-oxido-6-propan-2-ylpyridin-1-ium-2-carboxamide.
| Compound Name | N-[6-(cyclopropylmethoxy)-2-(4-ethynyl-4-hydroxycyclohexyl)indazol-5-yl]-1-oxido-6-propan-2-ylpyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 165162120 |
| Molecular Formula | C28H32N4O4 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | N-[6-(cyclopropylmethoxy)-2-(4-ethynyl-4-hydroxycyclohexyl)indazol-5-yl]-1-oxido-6-propan-2-ylpyridin-1-ium-2-carboxamide |
| SMILES | C#CC1(O)CCC(n2cc3cc(NC(=O)c4cccc(C(C)C)[n+]4[O-])c(OCC4CC4)cc3n2)CC1 |
| InChI | InChI=1S/C28H32N4O4/c1-4-28(34)12-10-21(11-13-28)31-16-20-14-23(26(15-22(20)30-31)36-17-19-8-9-19)29-27(33)25-7-5-6-24(18(2)3)32(25)35/h1,5-7,14-16,18-19,21,34H,8-13,17H2,2-3H3,(H,29,33) |
| InChIKey | MACHXXCUURIGJN-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|