C28H33N5O4 — CID 165162266
N-[2-[4-(cyanomethyl)-4-hydroxycyclohexyl]-6-(cyclopropylmethoxy)indazol-5-yl]-1-oxido-6-propan-2-ylpyridin-1-ium-2-carboxamide (PubChem CID 165162266) has the molecular formula C28H33N5O4 and a molecular weight of 503.60 g/mol. Its IUPAC name is N-[2-[4-(cyanomethyl)-4-hydroxycyclohexyl]-6-(cyclopropylmethoxy)indazol-5-yl]-1-oxido-6-propan-2-ylpyridin-1-ium-2-carboxamide.
| Compound Name | N-[2-[4-(cyanomethyl)-4-hydroxycyclohexyl]-6-(cyclopropylmethoxy)indazol-5-yl]-1-oxido-6-propan-2-ylpyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 165162266 |
| Molecular Formula | C28H33N5O4 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | N-[2-[4-(cyanomethyl)-4-hydroxycyclohexyl]-6-(cyclopropylmethoxy)indazol-5-yl]-1-oxido-6-propan-2-ylpyridin-1-ium-2-carboxamide |
| SMILES | CC(C)c1cccc(C(=O)Nc2cc3cn(C4CCC(O)(CC#N)CC4)nc3cc2OCC2CC2)[n+]1[O-] |
| InChI | InChI=1S/C28H33N5O4/c1-18(2)24-4-3-5-25(33(24)36)27(34)30-23-14-20-16-32(21-8-10-28(35,11-9-21)12-13-29)31-22(20)15-26(23)37-17-19-6-7-19/h3-5,14-16,18-19,21,35H,6-12,17H2,1-2H3,(H,30,34) |
| InChIKey | WPBHPIQKRVLRTI-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 127.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|