C24H27N5O4 — CID 176755694
N-[2-(4-cyano-4-hydroxycyclohexyl)-6-methoxyindazol-5-yl]-1-oxido-6-propan-2-ylpyridin-1-ium-2-carboxamide (PubChem CID 176755694) has the molecular formula C24H27N5O4 and a molecular weight of 449.51 g/mol. Its IUPAC name is N-[2-(4-cyano-4-hydroxycyclohexyl)-6-methoxyindazol-5-yl]-1-oxido-6-propan-2-ylpyridin-1-ium-2-carboxamide.
| Compound Name | N-[2-(4-cyano-4-hydroxycyclohexyl)-6-methoxyindazol-5-yl]-1-oxido-6-propan-2-ylpyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 176755694 |
| Molecular Formula | C24H27N5O4 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | N-[2-(4-cyano-4-hydroxycyclohexyl)-6-methoxyindazol-5-yl]-1-oxido-6-propan-2-ylpyridin-1-ium-2-carboxamide |
| SMILES | COc1cc2nn(C3CCC(O)(C#N)CC3)cc2cc1NC(=O)c1cccc(C(C)C)[n+]1[O-] |
| InChI | InChI=1S/C24H27N5O4/c1-15(2)20-5-4-6-21(29(20)32)23(30)26-19-11-16-13-28(27-18(16)12-22(19)33-3)17-7-9-24(31,14-25)10-8-17/h4-6,11-13,15,17,31H,7-10H2,1-3H3,(H,26,30) |
| InChIKey | QBXVQWPOGHXAMQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 127.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|