C21H22F2N4O4 — CID 165162351
6-(difluoromethyl)-N-[2-(4-hydroxycyclohexyl)-6-methoxyindazol-5-yl]-1-oxidopyridin-1-ium-2-carboxamide (PubChem CID 165162351) has the molecular formula C21H22F2N4O4 and a molecular weight of 432.43 g/mol. Its IUPAC name is 6-(difluoromethyl)-N-[2-(4-hydroxycyclohexyl)-6-methoxyindazol-5-yl]-1-oxidopyridin-1-ium-2-carboxamide.
| Compound Name | 6-(difluoromethyl)-N-[2-(4-hydroxycyclohexyl)-6-methoxyindazol-5-yl]-1-oxidopyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 165162351 |
| Molecular Formula | C21H22F2N4O4 |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 6-(difluoromethyl)-N-[2-(4-hydroxycyclohexyl)-6-methoxyindazol-5-yl]-1-oxidopyridin-1-ium-2-carboxamide |
| SMILES | COc1cc2nn(C3CCC(O)CC3)cc2cc1NC(=O)c1cccc(C(F)F)[n+]1[O-] |
| InChI | InChI=1S/C21H22F2N4O4/c1-31-19-10-15-12(11-26(25-15)13-5-7-14(28)8-6-13)9-16(19)24-21(29)18-4-2-3-17(20(22)23)27(18)30/h2-4,9-11,13-14,20,28H,5-8H2,1H3,(H,24,29) |
| InChIKey | VDJNWIMRVYSYST-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|