C22H28N5O4+ — CID 170360278
6-(dimethylamino)-1-hydroxy-N-[2-(4-hydroxycyclohexyl)-6-methoxyindazol-5-yl]pyridin-1-ium-2-carboxamide (PubChem CID 170360278) has the molecular formula C22H28N5O4+ and a molecular weight of 426.50 g/mol. Its IUPAC name is 6-(dimethylamino)-1-hydroxy-N-[2-(4-hydroxycyclohexyl)-6-methoxyindazol-5-yl]pyridin-1-ium-2-carboxamide.
| Compound Name | 6-(dimethylamino)-1-hydroxy-N-[2-(4-hydroxycyclohexyl)-6-methoxyindazol-5-yl]pyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 170360278 |
| Molecular Formula | C22H28N5O4+ |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 6-(dimethylamino)-1-hydroxy-N-[2-(4-hydroxycyclohexyl)-6-methoxyindazol-5-yl]pyridin-1-ium-2-carboxamide |
| SMILES | COc1cc2nn(C3CCC(O)CC3)cc2cc1NC(=O)c1cccc(N(C)C)[n+]1O |
| InChI | InChI=1S/C22H27N5O4/c1-25(2)21-6-4-5-19(27(21)30)22(29)23-18-11-14-13-26(15-7-9-16(28)10-8-15)24-17(14)12-20(18)31-3/h4-6,11-13,15-16,28H,7-10H2,1-3H3,(H-,23,29,30)/p+1 |
| InChIKey | KKXQYFPPKZIYQR-UHFFFAOYSA-O |
| XLogP | 2.36 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|