C25H33F2N3O2 — CID 155751873
N-(2-cyclohexyl-6-methoxyindazol-5-yl)-2,3-difluorobenzamide;ethane (PubChem CID 155751873) has the molecular formula C25H33F2N3O2 and a molecular weight of 445.55 g/mol. Its IUPAC name is N-(2-cyclohexyl-6-methoxyindazol-5-yl)-2,3-difluorobenzamide;ethane.
| Compound Name | N-(2-cyclohexyl-6-methoxyindazol-5-yl)-2,3-difluorobenzamide;ethane |
|---|---|
| PubChem CID | 155751873 |
| Molecular Formula | C25H33F2N3O2 |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | N-(2-cyclohexyl-6-methoxyindazol-5-yl)-2,3-difluorobenzamide;ethane |
| SMILES | CC.CC.COc1cc2nn(C3CCCCC3)cc2cc1NC(=O)c1cccc(F)c1F |
| InChI | InChI=1S/C21H21F2N3O2.2C2H6/c1-28-19-11-17-13(12-26(25-17)14-6-3-2-4-7-14)10-18(19)24-21(27)15-8-5-9-16(22)20(15)23;2*1-2/h5,8-12,14H,2-4,6-7H2,1H3,(H,24,27);2*1-2H3 |
| InChIKey | SRSIFPITCBUVOM-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |