C21H27N4O4+ — CID 170361041
(E)-[(3Z)-hexa-3,5-dien-2-ylidene]-hydroxy-[[2-(4-hydroxycyclohexyl)-6-methoxyindazol-5-yl]carbamoyl]azanium (PubChem CID 170361041) has the molecular formula C21H27N4O4+ and a molecular weight of 399.47 g/mol. Its IUPAC name is (E)-[(3Z)-hexa-3,5-dien-2-ylidene]-hydroxy-[[2-(4-hydroxycyclohexyl)-6-methoxyindazol-5-yl]carbamoyl]azanium.
| Compound Name | (E)-[(3Z)-hexa-3,5-dien-2-ylidene]-hydroxy-[[2-(4-hydroxycyclohexyl)-6-methoxyindazol-5-yl]carbamoyl]azanium |
|---|---|
| PubChem CID | 170361041 |
| Molecular Formula | C21H27N4O4+ |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | (E)-[(3Z)-hexa-3,5-dien-2-ylidene]-hydroxy-[[2-(4-hydroxycyclohexyl)-6-methoxyindazol-5-yl]carbamoyl]azanium |
| SMILES | C=C/C=C\C(C)=[N+](\O)C(=O)Nc1cc2cn(C3CCC(O)CC3)nc2cc1OC |
| InChI | InChI=1S/C21H26N4O4/c1-4-5-6-14(2)25(28)21(27)22-19-11-15-13-24(16-7-9-17(26)10-8-16)23-18(15)12-20(19)29-3/h4-6,11-13,16-17,26H,1,7-10H2,2-3H3,(H-,22,27,28)/p+1/b6-5-,25-14+ |
| InChIKey | CPEBVZYPNNANEL-VREKJVPHSA-O |
| XLogP | 3.66 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|