C22H29N4O4+ — CID 170361051
(E)-[6-ethoxy-2-(4-hydroxycyclohexyl)indazol-5-yl]carbamoyl-[(3Z)-hexa-3,5-dien-2-ylidene]-hydroxyazanium (PubChem CID 170361051) has the molecular formula C22H29N4O4+ and a molecular weight of 413.50 g/mol. Its IUPAC name is (E)-[6-ethoxy-2-(4-hydroxycyclohexyl)indazol-5-yl]carbamoyl-[(3Z)-hexa-3,5-dien-2-ylidene]-hydroxyazanium.
| Compound Name | (E)-[6-ethoxy-2-(4-hydroxycyclohexyl)indazol-5-yl]carbamoyl-[(3Z)-hexa-3,5-dien-2-ylidene]-hydroxyazanium |
|---|---|
| PubChem CID | 170361051 |
| Molecular Formula | C22H29N4O4+ |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | (E)-[6-ethoxy-2-(4-hydroxycyclohexyl)indazol-5-yl]carbamoyl-[(3Z)-hexa-3,5-dien-2-ylidene]-hydroxyazanium |
| SMILES | C=C/C=C\C(C)=[N+](\O)C(=O)Nc1cc2cn(C3CCC(O)CC3)nc2cc1OCC |
| InChI | InChI=1S/C22H28N4O4/c1-4-6-7-15(3)26(29)22(28)23-20-12-16-14-25(17-8-10-18(27)11-9-17)24-19(16)13-21(20)30-5-2/h4,6-7,12-14,17-18,27H,1,5,8-11H2,2-3H3,(H-,23,28,29)/p+1/b7-6-,26-15+ |
| InChIKey | ZDVPBRHWEVSQCU-DFSHTJFESA-O |
| XLogP | 4.05 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|