C21H23F2IN4O3 — CID 170358862
(2Z,4Z,6E)-N-[2-(4,4-difluorocyclohexyl)-6-methoxyindazol-5-yl]-6-hydroxyimino-2-iodohepta-2,4-dienamide (PubChem CID 170358862) has the molecular formula C21H23F2IN4O3 and a molecular weight of 544.34 g/mol. Its IUPAC name is (2Z,4Z,6E)-N-[2-(4,4-difluorocyclohexyl)-6-methoxyindazol-5-yl]-6-hydroxyimino-2-iodohepta-2,4-dienamide.
| Compound Name | (2Z,4Z,6E)-N-[2-(4,4-difluorocyclohexyl)-6-methoxyindazol-5-yl]-6-hydroxyimino-2-iodohepta-2,4-dienamide |
|---|---|
| PubChem CID | 170358862 |
| Molecular Formula | C21H23F2IN4O3 |
| Molecular Weight | 544.34 g/mol |
| Exact Mass | 544.08 |
| IUPAC Name | (2Z,4Z,6E)-N-[2-(4,4-difluorocyclohexyl)-6-methoxyindazol-5-yl]-6-hydroxyimino-2-iodohepta-2,4-dienamide |
| SMILES | COc1cc2nn(C3CCC(F)(F)CC3)cc2cc1NC(=O)/C(I)=C/C=C\C(C)=N\O |
| InChI | InChI=1S/C21H23F2IN4O3/c1-13(27-30)4-3-5-16(24)20(29)25-18-10-14-12-28(26-17(14)11-19(18)31-2)15-6-8-21(22,23)9-7-15/h3-5,10-12,15,30H,6-9H2,1-2H3,(H,25,29)/b4-3-,16-5-,27-13+ |
| InChIKey | FHUUWCFNQDYGMN-PKFQMMEBSA-N |
| XLogP | 5.46 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.34 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|