C29H35N5O3 — CID 165162134
6-cyclopropyl-N-[2-(4-cyclopropyl-4-hydroxycyclohexyl)-6-pyrrolidin-1-ylindazol-5-yl]-1-oxidopyridin-1-ium-2-carboxamide (PubChem CID 165162134) has the molecular formula C29H35N5O3 and a molecular weight of 501.63 g/mol. Its IUPAC name is 6-cyclopropyl-N-[2-(4-cyclopropyl-4-hydroxycyclohexyl)-6-pyrrolidin-1-ylindazol-5-yl]-1-oxidopyridin-1-ium-2-carboxamide.
| Compound Name | 6-cyclopropyl-N-[2-(4-cyclopropyl-4-hydroxycyclohexyl)-6-pyrrolidin-1-ylindazol-5-yl]-1-oxidopyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 165162134 |
| Molecular Formula | C29H35N5O3 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.27 |
| IUPAC Name | 6-cyclopropyl-N-[2-(4-cyclopropyl-4-hydroxycyclohexyl)-6-pyrrolidin-1-ylindazol-5-yl]-1-oxidopyridin-1-ium-2-carboxamide |
| SMILES | O=C(Nc1cc2cn(C3CCC(O)(C4CC4)CC3)nc2cc1N1CCCC1)c1cccc(C2CC2)[n+]1[O-] |
| InChI | InChI=1S/C29H35N5O3/c35-28(26-5-3-4-25(34(26)37)19-6-7-19)30-24-16-20-18-33(22-10-12-29(36,13-11-22)21-8-9-21)31-23(20)17-27(24)32-14-1-2-15-32/h3-5,16-19,21-22,36H,1-2,6-15H2,(H,30,35) |
| InChIKey | UORHLTMIPXDBGJ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|