C25H33N4O4+ — CID 170355088
N-[4-amino-2-ethoxy-5-[[3-(2-hydroxypropan-2-yl)cyclobutyl]iminomethyl]phenyl]-6-cyclopropyl-1-hydroxypyridin-1-ium-2-carboxamide (PubChem CID 170355088) has the molecular formula C25H33N4O4+ and a molecular weight of 453.56 g/mol. Its IUPAC name is N-[4-amino-2-ethoxy-5-[[3-(2-hydroxypropan-2-yl)cyclobutyl]iminomethyl]phenyl]-6-cyclopropyl-1-hydroxypyridin-1-ium-2-carboxamide.
| Compound Name | N-[4-amino-2-ethoxy-5-[[3-(2-hydroxypropan-2-yl)cyclobutyl]iminomethyl]phenyl]-6-cyclopropyl-1-hydroxypyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 170355088 |
| Molecular Formula | C25H33N4O4+ |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | N-[4-amino-2-ethoxy-5-[[3-(2-hydroxypropan-2-yl)cyclobutyl]iminomethyl]phenyl]-6-cyclopropyl-1-hydroxypyridin-1-ium-2-carboxamide |
| SMILES | CCOc1cc(N)c(/C=N/C2CC(C(C)(C)O)C2)cc1NC(=O)c1cccc(C2CC2)[n+]1O |
| InChI | InChI=1S/C25H32N4O4/c1-4-33-23-13-19(26)16(14-27-18-11-17(12-18)25(2,3)31)10-20(23)28-24(30)22-7-5-6-21(29(22)32)15-8-9-15/h5-7,10,13-15,17-18,26,30-32H,4,8-9,11-12H2,1-3H3/p+1/b27-14+ |
| InChIKey | LORNHNAUHQSKSF-MZJWZYIUSA-O |
| XLogP | 3.29 |
| TPSA | 121.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|