C28H35N4O3+ — CID 170355773
6-cyclopropyl-N-[(3Z)-3-[[(4-cyclopropylcyclohexyl)methylideneamino]methylidene]-6-ethoxy-4-iminocyclohexa-1,5-dien-1-yl]-1-hydroxypyridin-1-ium-2-carboxamide (PubChem CID 170355773) has the molecular formula C28H35N4O3+ and a molecular weight of 475.61 g/mol. Its IUPAC name is 6-cyclopropyl-N-[(3Z)-3-[[(4-cyclopropylcyclohexyl)methylideneamino]methylidene]-6-ethoxy-4-iminocyclohexa-1,5-dien-1-yl]-1-hydroxypyridin-1-ium-2-carboxamide.
| Compound Name | 6-cyclopropyl-N-[(3Z)-3-[[(4-cyclopropylcyclohexyl)methylideneamino]methylidene]-6-ethoxy-4-iminocyclohexa-1,5-dien-1-yl]-1-hydroxypyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 170355773 |
| Molecular Formula | C28H35N4O3+ |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.27 |
| IUPAC Name | 6-cyclopropyl-N-[(3Z)-3-[[(4-cyclopropylcyclohexyl)methylideneamino]methylidene]-6-ethoxy-4-iminocyclohexa-1,5-dien-1-yl]-1-hydroxypyridin-1-ium-2-carboxamide |
| SMILES | [H]/N=C1\C=C(OCC)C(NC(=O)c2cccc(C3CC3)[n+]2O)=C\C1=C\N=C\C1CCC(C2CC2)CC1 |
| InChI | InChI=1S/C28H34N4O3/c1-2-35-27-15-23(29)22(17-30-16-18-6-8-19(9-7-18)20-10-11-20)14-24(27)31-28(33)26-5-3-4-25(32(26)34)21-12-13-21/h3-5,14-21,29H,2,6-13H2,1H3,(H-,31,33,34)/p+1/b29-23+ |
| InChIKey | QSFBCZYKAHQCHD-BYNJWEBRSA-O |
| XLogP | 4.83 |
| TPSA | 98.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|