C25H30N4O4+2 — CID 170359758
4-cyclopropyl-4-hydroxy-N-[(Z)-[3-[(1-hydroxy-6-methylpyridin-1-ium-2-carbonyl)amino]-6-imino-4-methoxycyclohexa-2,4-dien-1-ylidene]methyl]cyclohexane-1-carbonitrilium (PubChem CID 170359758) has the molecular formula C25H30N4O4+2 and a molecular weight of 450.54 g/mol. Its IUPAC name is 4-cyclopropyl-4-hydroxy-N-[(Z)-[3-[(1-hydroxy-6-methylpyridin-1-ium-2-carbonyl)amino]-6-imino-4-methoxycyclohexa-2,4-dien-1-ylidene]methyl]cyclohexane-1-carbonitrilium.
| Compound Name | 4-cyclopropyl-4-hydroxy-N-[(Z)-[3-[(1-hydroxy-6-methylpyridin-1-ium-2-carbonyl)amino]-6-imino-4-methoxycyclohexa-2,4-dien-1-ylidene]methyl]cyclohexane-1-carbonitrilium |
|---|---|
| PubChem CID | 170359758 |
| Molecular Formula | C25H30N4O4+2 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | 4-cyclopropyl-4-hydroxy-N-[(Z)-[3-[(1-hydroxy-6-methylpyridin-1-ium-2-carbonyl)amino]-6-imino-4-methoxycyclohexa-2,4-dien-1-ylidene]methyl]cyclohexane-1-carbonitrilium |
| SMILES | [H]/N=C1\C=C(OC)C(NC(=O)c2cccc(C)[n+]2O)=C\C1=C\[N+]#CC1CCC(O)(C2CC2)CC1 |
| InChI | InChI=1S/C25H29N4O4/c1-16-4-3-5-22(29(16)32)24(30)28-21-12-18(20(26)13-23(21)33-2)15-27-14-17-8-10-25(31,11-9-17)19-6-7-19/h3-5,12-13,15,17,19,26,31H,6-11H2,1-2H3,(H-,28,30,32)/q+1/p+1/b18-15-,26-20+ |
| InChIKey | ZKXKSPIGTQRJOT-RXGFOIFJSA-O |
| XLogP | 3.25 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|