C25H29N3O4+2 — CID 170361364
N-[2-(4-cyclopropyl-4-hydroxycyclohexyl)-6-methoxyindol-1-ium-5-yl]-1-hydroxy-6-methylpyridin-1-ium-2-carboxamide (PubChem CID 170361364) has the molecular formula C25H29N3O4+2 and a molecular weight of 435.52 g/mol. Its IUPAC name is N-[2-(4-cyclopropyl-4-hydroxycyclohexyl)-6-methoxyindol-1-ium-5-yl]-1-hydroxy-6-methylpyridin-1-ium-2-carboxamide.
| Compound Name | N-[2-(4-cyclopropyl-4-hydroxycyclohexyl)-6-methoxyindol-1-ium-5-yl]-1-hydroxy-6-methylpyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 170361364 |
| Molecular Formula | C25H29N3O4+2 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | N-[2-(4-cyclopropyl-4-hydroxycyclohexyl)-6-methoxyindol-1-ium-5-yl]-1-hydroxy-6-methylpyridin-1-ium-2-carboxamide |
| SMILES | COc1cc2c(cc1NC(=O)c1cccc(C)[n+]1O)=CC(C1CCC(O)(C3CC3)CC1)=[N+]=2 |
| InChI | InChI=1S/C25H28N3O4/c1-15-4-3-5-22(28(15)31)24(29)27-21-13-17-12-19(26-20(17)14-23(21)32-2)16-8-10-25(30,11-9-16)18-6-7-18/h3-5,12-14,16,18,30H,6-11H2,1-2H3,(H,29,31)/q+1/p+1 |
| InChIKey | USGIQFWASXZEAL-UHFFFAOYSA-O |
| XLogP | 1.03 |
| TPSA | 96.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|